Hotplate Accessories
eMolecules 915088-14-1 | Ambeed | NN-Diphenyl-3-(4455-tetramethyl-132-dioxaborolan-2-yl)aniline | 250mg | 650569878 | A1004779 | 371.29 | C24H26BNO2
Ambeed | NN-Diphenyl-3-(4455-tetramethyl-132-dioxaborolan-2-yl)aniline | 250mg | 650569878 | A1004779 | 915088-14-1 | 371.290 | C24H26BNO2
![eMolecules N-(Azide-PEG8-carbonyl)-N-bis(PEG8-t-butyl ester) | Broadpharm |1427.722 | C65H126N4O29 | 98.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C)C(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] | 100mg | 798871012](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502472796.JPG-250.jpg)
eMolecules N-(Azide-PEG8-carbonyl)-N-bis(PEG8-t-butyl ester) | Broadpharm |1427.722 | C65H126N4O29 | 98.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C)C(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] | 100mg | 798871012
N-(Azide-PEG8-carbonyl)-N-bis(PEG8-t-butyl ester) | Broadpharm |1427.722 | C65H126N4O29 | 98.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C)C(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] | 100mg | 798871012
eMolecules 1610350-91-8 | Ambeed | Sodium (S)-2-amino-3-(4-((hydroxyoxidophosphoryl)oxy)phenyl)propanoate | 100g | 779507337 | A1280625 | 305.133 | C9H10NNa2O6P
Ambeed | 2-Bromoisophthalic acid | 1g | 633664190 | A698483 | 22433-91-6 | MFCD00099229 | 245.028 | C8H5BrO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 93-97-0 | Benzoic anhydride | Ambeed | MFCD00003073 | 226.231 | C14H10O3 | 95.000 | O=C(OC(=O)c1ccccc1)c1ccccc1 | 25g | 525154953
Benzoic anhydride | Ambeed | 93-97-0 | MFCD00003073 | 226.231 | C14H10O3 | 95.000 | O=C(OC(=O)c1ccccc1)c1ccccc1 | 25g | 525154953
eMolecules 23377-40-4 | Ambeed | 3-(Hexadecyloxy)propan-1-ol | 250mg | 525100017 | A182606 | MFCD00171483 | 300.527 | C19H40O2
ChemScene | 3-Morpholino-56-dihydropyridin-2(1H)-one | 100mg | 536795771 | CS-0063174 | 545445-40-7 | MFCD18072442 | 182.223 | C9H14N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 19264-73-4 | Ambeed | 9-(p-Tolyl)-9H-carbazole | 250mg | 628567600 | A447114 | MFCD14708175 | 257.336 | C19H15N
Ambeed | 6-Nitronaphthalen-2-amine | 250mg | 552666117 | A234672 | 3230-35-1 | MFCD00046485 | 188.186 | C10H8N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
=O)OC(=O)CCCCCCCCCCCCC | 250mg | 795361518](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477881.JPG-250.jpg)
eMolecules 2172921-69-4 | DMG-Nitrophenyl Carbonate | Broadpharm677.920 | C38H63NO9 | 98.000 | CCCCCCCCCCCCCC(=O)OCC(COC(=O)Oc1ccc(cc1)[N+]([O-])=O)OC(=O)CCCCCCCCCCCCC | 250mg | 795361518
DMG-Nitrophenyl Carbonate | Broadpharm | 2172921-69-4677.920 | C38H63NO9 | 98.000 | CCCCCCCCCCCCCC(=O)OCC(COC(=O)Oc1ccc(cc1)[N+]([O-])=O)OC(=O)CCCCCCCCCCCCC | 250mg | 795361518
![eMolecules 402936-15-6 | Dibenzo[b,d]furan-2-ylboronic acid | Ambeed | MFCD11183307 | 212.010 | C12H9BO3 | 95.000 | OB(O)c1ccc2oc3ccccc3c2c1 | 1g | 552684158](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502418971.PNG-250.jpg)
eMolecules 402936-15-6 | Dibenzo[b,d]furan-2-ylboronic acid | Ambeed | MFCD11183307 | 212.010 | C12H9BO3 | 95.000 | OB(O)c1ccc2oc3ccccc3c2c1 | 1g | 552684158
Dibenzo[b,d]furan-2-ylboronic acid | Ambeed | 402936-15-6 | MFCD11183307 | 212.010 | C12H9BO3 | 95.000 | OB(O)c1ccc2oc3ccccc3c2c1 | 1g | 552684158
Electron Microscopy Sciences Corning Digital Stirring Hot Plate Support Rod, 5/16" x 18"L
Corning hot plates, stirrers and hot plate/stirrers have a space for a support rod that screws in the base of the unit. The support rods are constructed from stainless steel, size: 5⁄16" x 18"L, use with models: PC-400/410/4/305.
Use: PC-400/410/4/305
eMolecules 2143456-42-0 | ChemScene | 25-Dipropoxyterephthalohydrazide | 100mg | 626491949 | CS-0146313 | 310.354 | C14H22N4O4
Ambeed | (R)-Chroman-2-ylmethanamine hydrochloride | 1g | 525101659 | A184148 | 437763-66-1 | MFCD01863317 | 199.680 | C10H14ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 7311-34-4 | 3,5-Dimethoxybenzaldehyde | Ambeed | MFCD00003366 | 166.176 | C9H10O3 | 97.000 | COc1cc(OC)cc(C=O)c1 | 1g | 552706655
3,5-Dimethoxybenzaldehyde | Ambeed | 7311-34-4 | MFCD00003366 | 166.176 | C9H10O3 | 97.000 | COc1cc(OC)cc(C=O)c1 | 1g | 552706655
eMolecules 2375588-89-7 | 7-fluoro-8-methylnaphthalen-1-yl trifluoromethanesulfonate | Synthonix308.250 | C12H8F4O3S | 95.000 | Cc1c(F)ccc2cccc(OS(=O)(=O)C(F)(F)F)c12 | 500mg | 784552854
7-fluoro-8-methylnaphthalen-1-yl trifluoromethanesulfonate | Synthonix | 2375588-89-7308.250 | C12H8F4O3S | 95.000 | Cc1c(F)ccc2cccc(OS(=O)(=O)C(F)(F)F)c12 | 500mg | 784552854
eMolecules 942631-50-7 | tert-Butyl thiazol-5-ylcarbamate | Ambeed | MFCD11977627 | 200.260 | C8H12N2O2S | 97.000 | CC(C)(C)OC(=O)Nc1cncs1 | 100mg | 600849886
tert-Butyl thiazol-5-ylcarbamate | Ambeed | 942631-50-7 | MFCD11977627 | 200.260 | C8H12N2O2S | 97.000 | CC(C)(C)OC(=O)Nc1cncs1 | 100mg | 600849886
eMolecules 6372-40-3 | Ambeed | Isopropyldiphenylphosphine | 250mg | 534580692 | A343809 | MFCD00015028 | 228.275 | C15H17P
Ambeed | Isopropyldiphenylphosphine | 250mg | 534580692 | A343809 | 6372-40-3 | MFCD00015028 | 228.275 | C15H17P
![eMolecules 43088-64-8 | Ambeed | 5-Methylthieno[23d]pyrimidin-4(3H)-one | 100mg | 682931702 | A745170 | MFCD00205193 | 166.2 | C7H6N2OS](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502437064.JPG-250.jpg)
eMolecules 43088-64-8 | Ambeed | 5-Methylthieno[23d]pyrimidin-4(3H)-one | 100mg | 682931702 | A745170 | MFCD00205193 | 166.2 | C7H6N2OS
Medchem Express | Suplatast (Tosilate) | 100mg | 446268103 | HY-17002 | 94055-76-2 | MFCD00867604 | 499.640 | C23H33NO7S2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>